C23H40NO6P — CID 67677034
CID 67677034 (PubChem CID 67677034) has the molecular formula C23H40NO6P and a molecular weight of 457.55 g/mol.
| Compound Name | CID 67677034 |
|---|---|
| PubChem CID | 67677034 |
| Molecular Formula | C23H40NO6P |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | — |
| SMILES | CCCCCCC(CO)NC(=O)CCCCC.O=P(=O)C(O)COCc1ccccc1 |
| InChI | InChI=1S/C14H29NO2.C9H11O4P/c1-3-5-7-9-10-13(12-16)15-14(17)11-8-6-4-2;10-9(14(11)12)7-13-6-8-4-2-1-3-5-8/h13,16H,3-12H2,1-2H3,(H,15,17);1-5,9-10H,6-7H2 |
| InChIKey | ODTWNIFHEXNBSV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|