C29H52NO6P — CID 159166605
N-(1-hydroxyoctan-2-yl)dodecanamide;oxido-oxo-(2-phenylmethoxyethoxy)phosphanium (PubChem CID 159166605) has the molecular formula C29H52NO6P and a molecular weight of 541.71 g/mol. Its IUPAC name is N-(1-hydroxyoctan-2-yl)dodecanamide;oxido-oxo-(2-phenylmethoxyethoxy)phosphanium.
| Compound Name | N-(1-hydroxyoctan-2-yl)dodecanamide;oxido-oxo-(2-phenylmethoxyethoxy)phosphanium |
|---|---|
| PubChem CID | 159166605 |
| Molecular Formula | C29H52NO6P |
| Molecular Weight | 541.71 g/mol |
| Exact Mass | 541.35 |
| IUPAC Name | N-(1-hydroxyoctan-2-yl)dodecanamide;oxido-oxo-(2-phenylmethoxyethoxy)phosphanium |
| SMILES | CCCCCCCCCCCC(=O)NC(CO)CCCCCC.O=[P+]([O-])OCCOCc1ccccc1 |
| InChI | InChI=1S/C20H41NO2.C9H11O4P/c1-3-5-7-9-10-11-12-13-15-17-20(23)21-19(18-22)16-14-8-6-4-2;10-14(11)13-7-6-12-8-9-4-2-1-3-5-9/h19,22H,3-18H2,1-2H3,(H,21,23);1-5H,6-8H2 |
| InChIKey | KLDNYVNVLGXJAW-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 107.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.71 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|