C27H50NO7PS — CID 67677271
CID 67677271 (PubChem CID 67677271) has the molecular formula C27H50NO7PS and a molecular weight of 563.74 g/mol.
| Compound Name | CID 67677271 |
|---|---|
| PubChem CID | 67677271 |
| Molecular Formula | C27H50NO7PS |
| Molecular Weight | 563.74 g/mol |
| Exact Mass | 563.30 |
| IUPAC Name | — |
| SMILES | CCCCCCCCCCS(=O)(=O)N[C@@H](CO)CCCCCC.O=P(=O)C(O)COCc1ccccc1 |
| InChI | InChI=1S/C18H39NO3S.C9H11O4P/c1-3-5-7-9-10-11-12-14-16-23(21,22)19-18(17-20)15-13-8-6-4-2;10-9(14(11)12)7-13-6-8-4-2-1-3-5-8/h18-20H,3-17H2,1-2H3;1-5,9-10H,6-7H2/t18-;/m1./s1 |
| InChIKey | NIYADYOSDUYCNW-GMUIIQOCSA-N |
| XLogP | 6.07 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.74 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|