C37H53NO3S — CID 23202661
N-(1-trityloxyoctan-2-yl)decane-1-sulfonamide (PubChem CID 23202661) has the molecular formula C37H53NO3S and a molecular weight of 591.90 g/mol. Its IUPAC name is N-(1-trityloxyoctan-2-yl)decane-1-sulfonamide.
| Compound Name | N-(1-trityloxyoctan-2-yl)decane-1-sulfonamide |
|---|---|
| PubChem CID | 23202661 |
| Molecular Formula | C37H53NO3S |
| Molecular Weight | 591.90 g/mol |
| Exact Mass | 591.37 |
| IUPAC Name | N-(1-trityloxyoctan-2-yl)decane-1-sulfonamide |
| SMILES | CCCCCCCCCCS(=O)(=O)NC(CCCCCC)COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H53NO3S/c1-3-5-7-9-10-11-12-23-31-42(39,40)38-36(30-22-8-6-4-2)32-41-37(33-24-16-13-17-25-33,34-26-18-14-19-27-34)35-28-20-15-21-29-35/h13-21,24-29,36,38H,3-12,22-23,30-32H2,1-2H3 |
| InChIKey | FFNNWEVQLAAVMW-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.90 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|