C26H39NO8PS+ — CID 57044122
trihydroxy-[3-hydroxy-2-phenylmethoxy-4-(3-phenylpropylsulfonylamino)decanoyl]phosphanium (PubChem CID 57044122) has the molecular formula C26H39NO8PS+ and a molecular weight of 556.64 g/mol. Its IUPAC name is trihydroxy-[3-hydroxy-2-phenylmethoxy-4-(3-phenylpropylsulfonylamino)decanoyl]phosphanium.
| Compound Name | trihydroxy-[3-hydroxy-2-phenylmethoxy-4-(3-phenylpropylsulfonylamino)decanoyl]phosphanium |
|---|---|
| PubChem CID | 57044122 |
| Molecular Formula | C26H39NO8PS+ |
| Molecular Weight | 556.64 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | trihydroxy-[3-hydroxy-2-phenylmethoxy-4-(3-phenylpropylsulfonylamino)decanoyl]phosphanium |
| SMILES | CCCCCCC(NS(=O)(=O)CCCc1ccccc1)C(O)C(OCc1ccccc1)C(=O)[P+](O)(O)O |
| InChI | InChI=1S/C26H39NO8PS/c1-2-3-4-11-18-23(27-37(33,34)19-12-17-21-13-7-5-8-14-21)24(28)25(26(29)36(30,31)32)35-20-22-15-9-6-10-16-22/h5-10,13-16,23-25,27-28,30-32H,2-4,11-12,17-20H2,1H3/q+1 |
| InChIKey | AETCDDKRFGHCOP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 153.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.64 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|