C16H23ClN2O2S — CID 120584320
N-(2-amino-1-naphthalen-2-ylethyl)butane-1-sulfonamide;hydrochloride (PubChem CID 120584320) has the molecular formula C16H23ClN2O2S and a molecular weight of 342.89 g/mol. Its IUPAC name is N-(2-amino-1-naphthalen-2-ylethyl)butane-1-sulfonamide;hydrochloride.
| Compound Name | N-(2-amino-1-naphthalen-2-ylethyl)butane-1-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120584320 |
| Molecular Formula | C16H23ClN2O2S |
| Molecular Weight | 342.89 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N-(2-amino-1-naphthalen-2-ylethyl)butane-1-sulfonamide;hydrochloride |
| SMILES | CCCCS(=O)(=O)NC(CN)c1ccc2ccccc2c1.Cl |
| InChI | InChI=1S/C16H22N2O2S.ClH/c1-2-3-10-21(19,20)18-16(12-17)15-9-8-13-6-4-5-7-14(13)11-15;/h4-9,11,16,18H,2-3,10,12,17H2,1H3;1H |
| InChIKey | VKOPECGGQZSIRF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.89 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |