C18H26ClN3O4S — CID 120567612
N-(2-amino-1-naphthalen-2-ylethyl)-2-(2-ethoxyethylsulfonylamino)acetamide;hydrochloride (PubChem CID 120567612) has the molecular formula C18H26ClN3O4S and a molecular weight of 415.94 g/mol. Its IUPAC name is N-(2-amino-1-naphthalen-2-ylethyl)-2-(2-ethoxyethylsulfonylamino)acetamide;hydrochloride.
| Compound Name | N-(2-amino-1-naphthalen-2-ylethyl)-2-(2-ethoxyethylsulfonylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120567612 |
| Molecular Formula | C18H26ClN3O4S |
| Molecular Weight | 415.94 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | N-(2-amino-1-naphthalen-2-ylethyl)-2-(2-ethoxyethylsulfonylamino)acetamide;hydrochloride |
| SMILES | CCOCCS(=O)(=O)NCC(=O)NC(CN)c1ccc2ccccc2c1.Cl |
| InChI | InChI=1S/C18H25N3O4S.ClH/c1-2-25-9-10-26(23,24)20-13-18(22)21-17(12-19)16-8-7-14-5-3-4-6-15(14)11-16;/h3-8,11,17,20H,2,9-10,12-13,19H2,1H3,(H,21,22);1H |
| InChIKey | XQCHCGHCOCSPMQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.94 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|