C20H28ClN3O3S — CID 120567466
N-(2-amino-1-naphthalen-2-ylethyl)-4-pyrrolidin-1-ylsulfonylbutanamide;hydrochloride (PubChem CID 120567466) has the molecular formula C20H28ClN3O3S and a molecular weight of 425.98 g/mol. Its IUPAC name is N-(2-amino-1-naphthalen-2-ylethyl)-4-pyrrolidin-1-ylsulfonylbutanamide;hydrochloride.
| Compound Name | N-(2-amino-1-naphthalen-2-ylethyl)-4-pyrrolidin-1-ylsulfonylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 120567466 |
| Molecular Formula | C20H28ClN3O3S |
| Molecular Weight | 425.98 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | N-(2-amino-1-naphthalen-2-ylethyl)-4-pyrrolidin-1-ylsulfonylbutanamide;hydrochloride |
| SMILES | Cl.NCC(NC(=O)CCCS(=O)(=O)N1CCCC1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H27N3O3S.ClH/c21-15-19(18-10-9-16-6-1-2-7-17(16)14-18)22-20(24)8-5-13-27(25,26)23-11-3-4-12-23;/h1-2,6-7,9-10,14,19H,3-5,8,11-13,15,21H2,(H,22,24);1H |
| InChIKey | AGUFYTCWKXHSHX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.98 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |