C17H23ClN2OS — CID 120567970
N-(2-amino-1-naphthalen-2-ylethyl)-4-methylsulfanylbutanamide;hydrochloride (PubChem CID 120567970) has the molecular formula C17H23ClN2OS and a molecular weight of 338.90 g/mol. Its IUPAC name is N-(2-amino-1-naphthalen-2-ylethyl)-4-methylsulfanylbutanamide;hydrochloride.
| Compound Name | N-(2-amino-1-naphthalen-2-ylethyl)-4-methylsulfanylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 120567970 |
| Molecular Formula | C17H23ClN2OS |
| Molecular Weight | 338.90 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | N-(2-amino-1-naphthalen-2-ylethyl)-4-methylsulfanylbutanamide;hydrochloride |
| SMILES | CSCCCC(=O)NC(CN)c1ccc2ccccc2c1.Cl |
| InChI | InChI=1S/C17H22N2OS.ClH/c1-21-10-4-7-17(20)19-16(12-18)15-9-8-13-5-2-3-6-14(13)11-15;/h2-3,5-6,8-9,11,16H,4,7,10,12,18H2,1H3,(H,19,20);1H |
| InChIKey | SUUWCSJLEADEON-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.90 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|