C17H26NO7P — CID 18378415
[2-(1,3-benzodioxol-5-yl)-2-(octanoylamino)ethyl] dihydrogen phosphate (PubChem CID 18378415) has the molecular formula C17H26NO7P and a molecular weight of 387.37 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-yl)-2-(octanoylamino)ethyl] dihydrogen phosphate.
| Compound Name | [2-(1,3-benzodioxol-5-yl)-2-(octanoylamino)ethyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 18378415 |
| Molecular Formula | C17H26NO7P |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | [2-(1,3-benzodioxol-5-yl)-2-(octanoylamino)ethyl] dihydrogen phosphate |
| SMILES | CCCCCCCC(=O)NC(COP(=O)(O)O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H26NO7P/c1-2-3-4-5-6-7-17(19)18-14(11-25-26(20,21)22)13-8-9-15-16(10-13)24-12-23-15/h8-10,14H,2-7,11-12H2,1H3,(H,18,19)(H2,20,21,22) |
| InChIKey | QVXYWIQOGMMNBO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|