C24H40N2O4 — CID 134398314
N-[(1S,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-hydroxy-3-(pentylamino)propan-2-yl]octanamide (PubChem CID 134398314) has the molecular formula C24H40N2O4 and a molecular weight of 420.59 g/mol. Its IUPAC name is N-[(1S,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-hydroxy-3-(pentylamino)propan-2-yl]octanamide.
| Compound Name | N-[(1S,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-hydroxy-3-(pentylamino)propan-2-yl]octanamide |
|---|---|
| PubChem CID | 134398314 |
| Molecular Formula | C24H40N2O4 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.30 |
| IUPAC Name | N-[(1S,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-hydroxy-3-(pentylamino)propan-2-yl]octanamide |
| SMILES | CCCCCCCC(=O)N[C@H](CNCCCCC)[C@@H](O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C24H40N2O4/c1-3-5-7-8-9-11-23(27)26-20(18-25-14-10-6-4-2)24(28)19-12-13-21-22(17-19)30-16-15-29-21/h12-13,17,20,24-25,28H,3-11,14-16,18H2,1-2H3,(H,26,27)/t20-,24+/m1/s1 |
| InChIKey | LJCLJTLUMLRBKU-YKSBVNFPSA-N |
| XLogP | 4.12 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|