C26H44N2O4 — CID 160876925
N-[(1R,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-hydroxy-3-(4-methylpiperidin-1-yl)propan-2-yl]octanamide;methane (PubChem CID 160876925) has the molecular formula C26H44N2O4 and a molecular weight of 448.65 g/mol. Its IUPAC name is N-[(1R,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-hydroxy-3-(4-methylpiperidin-1-yl)propan-2-yl]octanamide;methane.
| Compound Name | N-[(1R,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-hydroxy-3-(4-methylpiperidin-1-yl)propan-2-yl]octanamide;methane |
|---|---|
| PubChem CID | 160876925 |
| Molecular Formula | C26H44N2O4 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.33 |
| IUPAC Name | N-[(1R,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-hydroxy-3-(4-methylpiperidin-1-yl)propan-2-yl]octanamide;methane |
| SMILES | C.CCCCCCCC(=O)N[C@H](CN1CCC(C)CC1)[C@H](O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C25H40N2O4.CH4/c1-3-4-5-6-7-8-24(28)26-21(18-27-13-11-19(2)12-14-27)25(29)20-9-10-22-23(17-20)31-16-15-30-22;/h9-10,17,19,21,25,29H,3-8,11-16,18H2,1-2H3,(H,26,28);1H4/t21-,25-;/m1./s1 |
| InChIKey | SMNAXYRLORUNNI-UPWLLONGSA-N |
| XLogP | 4.70 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|