C24H36N2O4 — CID 148936737
N-[(1S,2R)-3-(3-azabicyclo[3.1.0]hexan-3-yl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-hydroxypropan-2-yl]octanamide (PubChem CID 148936737) has the molecular formula C24H36N2O4 and a molecular weight of 416.56 g/mol. Its IUPAC name is N-[(1S,2R)-3-(3-azabicyclo[3.1.0]hexan-3-yl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-hydroxypropan-2-yl]octanamide.
| Compound Name | N-[(1S,2R)-3-(3-azabicyclo[3.1.0]hexan-3-yl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-hydroxypropan-2-yl]octanamide |
|---|---|
| PubChem CID | 148936737 |
| Molecular Formula | C24H36N2O4 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | N-[(1S,2R)-3-(3-azabicyclo[3.1.0]hexan-3-yl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-hydroxypropan-2-yl]octanamide |
| SMILES | CCCCCCCC(=O)N[C@H](CN1CC2CC2C1)[C@@H](O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C24H36N2O4/c1-2-3-4-5-6-7-23(27)25-20(16-26-14-18-12-19(18)15-26)24(28)17-8-9-21-22(13-17)30-11-10-29-21/h8-9,13,18-20,24,28H,2-7,10-12,14-16H2,1H3,(H,25,27)/t18?,19?,20-,24+/m1/s1 |
| InChIKey | PNCFFTPZGUIWFB-DXXLFZTRSA-N |
| XLogP | 3.29 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|