C23H36N2O7S — CID 153357423
[(1R,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(octanoylamino)-3-pyrrolidin-1-ylpropyl] hydrogen sulfate (PubChem CID 153357423) has the molecular formula C23H36N2O7S and a molecular weight of 484.62 g/mol. Its IUPAC name is [(1R,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(octanoylamino)-3-pyrrolidin-1-ylpropyl] hydrogen sulfate.
| Compound Name | [(1R,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(octanoylamino)-3-pyrrolidin-1-ylpropyl] hydrogen sulfate |
|---|---|
| PubChem CID | 153357423 |
| Molecular Formula | C23H36N2O7S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | [(1R,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(octanoylamino)-3-pyrrolidin-1-ylpropyl] hydrogen sulfate |
| SMILES | CCCCCCCC(=O)N[C@H](CN1CCCC1)[C@H](OS(=O)(=O)O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C23H36N2O7S/c1-2-3-4-5-6-9-22(26)24-19(17-25-12-7-8-13-25)23(32-33(27,28)29)18-10-11-20-21(16-18)31-15-14-30-20/h10-11,16,19,23H,2-9,12-15,17H2,1H3,(H,24,26)(H,27,28,29)/t19-,23-/m1/s1 |
| InChIKey | JJKVOGIFRGTTPC-AUSIDOKSSA-N |
| XLogP | 3.26 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|