C29H45N3O6 — CID 170204308
[(1R,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(heptanoylamino)-3-pyrrolidin-1-ylpropyl] 3-morpholin-4-ylpropanoate (PubChem CID 170204308) has the molecular formula C29H45N3O6 and a molecular weight of 531.69 g/mol. Its IUPAC name is [(1R,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(heptanoylamino)-3-pyrrolidin-1-ylpropyl] 3-morpholin-4-ylpropanoate.
| Compound Name | [(1R,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(heptanoylamino)-3-pyrrolidin-1-ylpropyl] 3-morpholin-4-ylpropanoate |
|---|---|
| PubChem CID | 170204308 |
| Molecular Formula | C29H45N3O6 |
| Molecular Weight | 531.69 g/mol |
| Exact Mass | 531.33 |
| IUPAC Name | [(1R,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(heptanoylamino)-3-pyrrolidin-1-ylpropyl] 3-morpholin-4-ylpropanoate |
| SMILES | CCCCCCC(=O)N[C@H](CN1CCCC1)[C@H](OC(=O)CCN1CCOCC1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C29H45N3O6/c1-2-3-4-5-8-27(33)30-24(22-32-12-6-7-13-32)29(23-9-10-25-26(21-23)37-20-19-36-25)38-28(34)11-14-31-15-17-35-18-16-31/h9-10,21,24,29H,2-8,11-20,22H2,1H3,(H,30,33)/t24-,29-/m1/s1 |
| InChIKey | JVNAQVALNCAVME-FUFSCUOVSA-N |
| XLogP | 3.32 |
| TPSA | 89.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.69 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|