C24H37NO5 — CID 170203904
[(1R,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(octanoylamino)propyl] 2,2-dimethylpropanoate (PubChem CID 170203904) has the molecular formula C24H37NO5 and a molecular weight of 419.56 g/mol. Its IUPAC name is [(1R,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(octanoylamino)propyl] 2,2-dimethylpropanoate.
| Compound Name | [(1R,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(octanoylamino)propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 170203904 |
| Molecular Formula | C24H37NO5 |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | [(1R,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(octanoylamino)propyl] 2,2-dimethylpropanoate |
| SMILES | CCCCCCCC(=O)N[C@H](C)[C@H](OC(=O)C(C)(C)C)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C24H37NO5/c1-6-7-8-9-10-11-21(26)25-17(2)22(30-23(27)24(3,4)5)18-12-13-19-20(16-18)29-15-14-28-19/h12-13,16-17,22H,6-11,14-15H2,1-5H3,(H,25,26)/t17-,22+/m1/s1 |
| InChIKey | GICWIEBOAQCQCF-VGSWGCGISA-N |
| XLogP | 4.95 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|