C30H47NO6 — CID 158677812
[(1S,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxo-2-(pyrrolidin-1-ylmethyl)undecoxy]methyl 2,2-dimethylpropanoate (PubChem CID 158677812) has the molecular formula C30H47NO6 and a molecular weight of 517.71 g/mol. Its IUPAC name is [(1S,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxo-2-(pyrrolidin-1-ylmethyl)undecoxy]methyl 2,2-dimethylpropanoate.
| Compound Name | [(1S,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxo-2-(pyrrolidin-1-ylmethyl)undecoxy]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 158677812 |
| Molecular Formula | C30H47NO6 |
| Molecular Weight | 517.71 g/mol |
| Exact Mass | 517.34 |
| IUPAC Name | [(1S,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxo-2-(pyrrolidin-1-ylmethyl)undecoxy]methyl 2,2-dimethylpropanoate |
| SMILES | CCCCCCCC(=O)C[C@H](CN1CCCC1)[C@H](OCOC(=O)C(C)(C)C)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C30H47NO6/c1-5-6-7-8-9-12-25(32)19-24(21-31-15-10-11-16-31)28(36-22-37-29(33)30(2,3)4)23-13-14-26-27(20-23)35-18-17-34-26/h13-14,20,24,28H,5-12,15-19,21-22H2,1-4H3/t24-,28-/m1/s1 |
| InChIKey | IESXDTRNCOTOAO-UFHPHHKVSA-N |
| XLogP | 6.09 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.71 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|