C30H41N3O5 — CID 153357467
[(1R,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(octanoylamino)-3-pyrrolidin-1-ylpropyl] 2-aminobenzoate (PubChem CID 153357467) has the molecular formula C30H41N3O5 and a molecular weight of 523.67 g/mol. Its IUPAC name is [(1R,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(octanoylamino)-3-pyrrolidin-1-ylpropyl] 2-aminobenzoate.
| Compound Name | [(1R,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(octanoylamino)-3-pyrrolidin-1-ylpropyl] 2-aminobenzoate |
|---|---|
| PubChem CID | 153357467 |
| Molecular Formula | C30H41N3O5 |
| Molecular Weight | 523.67 g/mol |
| Exact Mass | 523.30 |
| IUPAC Name | [(1R,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(octanoylamino)-3-pyrrolidin-1-ylpropyl] 2-aminobenzoate |
| SMILES | CCCCCCCC(=O)N[C@H](CN1CCCC1)[C@H](OC(=O)c1ccccc1N)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C30H41N3O5/c1-2-3-4-5-6-13-28(34)32-25(21-33-16-9-10-17-33)29(38-30(35)23-11-7-8-12-24(23)31)22-14-15-26-27(20-22)37-19-18-36-26/h7-8,11-12,14-15,20,25,29H,2-6,9-10,13,16-19,21,31H2,1H3,(H,32,34)/t25-,29-/m1/s1 |
| InChIKey | WCSYSLSUGFZLSP-VAVYLYDRSA-N |
| XLogP | 4.88 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.67 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|