C25H38N2O4 — CID 142458543
N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-oxo-5-pyrrolidin-1-ylpentan-3-yl]octanamide (PubChem CID 142458543) has the molecular formula C25H38N2O4 and a molecular weight of 430.59 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-oxo-5-pyrrolidin-1-ylpentan-3-yl]octanamide.
| Compound Name | N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-oxo-5-pyrrolidin-1-ylpentan-3-yl]octanamide |
|---|---|
| PubChem CID | 142458543 |
| Molecular Formula | C25H38N2O4 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-oxo-5-pyrrolidin-1-ylpentan-3-yl]octanamide |
| SMILES | CCCCCCCC(=O)NC(CCN1CCCC1)C(C=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C25H38N2O4/c1-2-3-4-5-6-9-25(29)26-22(12-15-27-13-7-8-14-27)21(19-28)20-10-11-23-24(18-20)31-17-16-30-23/h10-11,18-19,21-22H,2-9,12-17H2,1H3,(H,26,29) |
| InChIKey | YUAIHCWWABRWQO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|