C23H36N2O4 — CID 121473294
N-[(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-hydroxy-3-pyrrolidin-1-ylpropyl]octanamide (PubChem CID 121473294) has the molecular formula C23H36N2O4 and a molecular weight of 404.55 g/mol. Its IUPAC name is N-[(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-hydroxy-3-pyrrolidin-1-ylpropyl]octanamide.
| Compound Name | N-[(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-hydroxy-3-pyrrolidin-1-ylpropyl]octanamide |
|---|---|
| PubChem CID | 121473294 |
| Molecular Formula | C23H36N2O4 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | N-[(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-hydroxy-3-pyrrolidin-1-ylpropyl]octanamide |
| SMILES | CCCCCCCC(=O)N[C@@](O)(CCN1CCCC1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C23H36N2O4/c1-2-3-4-5-6-9-22(26)24-23(27,12-15-25-13-7-8-14-25)19-10-11-20-21(18-19)29-17-16-28-20/h10-11,18,27H,2-9,12-17H2,1H3,(H,24,26)/t23-/m1/s1 |
| InChIKey | YJZFUGJRABGCCB-HSZRJFAPSA-N |
| XLogP | 3.57 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|