C28H37ClN2O3 — CID 162323533
(E)-3-(4-tert-butylphenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-pyrrolidin-1-ylhex-2-enamide;hydrochloride (PubChem CID 162323533) has the molecular formula C28H37ClN2O3 and a molecular weight of 485.07 g/mol. Its IUPAC name is (E)-3-(4-tert-butylphenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-pyrrolidin-1-ylhex-2-enamide;hydrochloride.
| Compound Name | (E)-3-(4-tert-butylphenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-pyrrolidin-1-ylhex-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 162323533 |
| Molecular Formula | C28H37ClN2O3 |
| Molecular Weight | 485.07 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | (E)-3-(4-tert-butylphenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-pyrrolidin-1-ylhex-2-enamide;hydrochloride |
| SMILES | CC(C)(C)c1ccc(/C(=C/C(=O)Nc2ccc3c(c2)OCCO3)CCCN2CCCC2)cc1.Cl |
| InChI | InChI=1S/C28H36N2O3.ClH/c1-28(2,3)23-10-8-21(9-11-23)22(7-6-16-30-14-4-5-15-30)19-27(31)29-24-12-13-25-26(20-24)33-18-17-32-25;/h8-13,19-20H,4-7,14-18H2,1-3H3,(H,29,31);1H/b22-19+; |
| InChIKey | NVJKAYCIEMZYCZ-KWNKHXGFSA-N |
| XLogP | 6.08 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.07 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|