C27H26ClNO3 — CID 76617112
3-(4-tert-butylphenyl)-3-(4-chlorophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enamide (PubChem CID 76617112) has the molecular formula C27H26ClNO3 and a molecular weight of 447.96 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-3-(4-chlorophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enamide.
| Compound Name | 3-(4-tert-butylphenyl)-3-(4-chlorophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 76617112 |
| Molecular Formula | C27H26ClNO3 |
| Molecular Weight | 447.96 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 3-(4-tert-butylphenyl)-3-(4-chlorophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enamide |
| SMILES | CC(C)(C)c1ccc(C(=CC(=O)Nc2ccc3c(c2)OCCO3)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C27H26ClNO3/c1-27(2,3)20-8-4-18(5-9-20)23(19-6-10-21(28)11-7-19)17-26(30)29-22-12-13-24-25(16-22)32-15-14-31-24/h4-13,16-17H,14-15H2,1-3H3,(H,29,30) |
| InChIKey | XUVMOZYPXVGNDU-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.96 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|