C17H17ClN2O3 — CID 17182454
1-[1-(4-chlorophenyl)ethyl]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)urea (PubChem CID 17182454) has the molecular formula C17H17ClN2O3 and a molecular weight of 332.79 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)ethyl]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)urea.
| Compound Name | 1-[1-(4-chlorophenyl)ethyl]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)urea |
|---|---|
| PubChem CID | 17182454 |
| Molecular Formula | C17H17ClN2O3 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 1-[1-(4-chlorophenyl)ethyl]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)urea |
| SMILES | CC(NC(=O)Nc1ccc2c(c1)OCCO2)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17ClN2O3/c1-11(12-2-4-13(18)5-3-12)19-17(21)20-14-6-7-15-16(10-14)23-9-8-22-15/h2-7,10-11H,8-9H2,1H3,(H2,19,20,21) |
| InChIKey | SIRXXJQCUYWPBW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |