C24H38N2O4 — CID 89296331
N-[(1S,2R)-1-(cyclopentylamino)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methoxyethyl]octanamide (PubChem CID 89296331) has the molecular formula C24H38N2O4 and a molecular weight of 418.58 g/mol. Its IUPAC name is N-[(1S,2R)-1-(cyclopentylamino)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methoxyethyl]octanamide.
| Compound Name | N-[(1S,2R)-1-(cyclopentylamino)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methoxyethyl]octanamide |
|---|---|
| PubChem CID | 89296331 |
| Molecular Formula | C24H38N2O4 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | N-[(1S,2R)-1-(cyclopentylamino)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methoxyethyl]octanamide |
| SMILES | CCCCCCCC(=O)N[C@H](NC1CCCC1)[C@H](OC)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C24H38N2O4/c1-3-4-5-6-7-12-22(27)26-24(25-19-10-8-9-11-19)23(28-2)18-13-14-20-21(17-18)30-16-15-29-20/h13-14,17,19,23-25H,3-12,15-16H2,1-2H3,(H,26,27)/t23-,24+/m1/s1 |
| InChIKey | VKYOIGOVYQNRFV-RPWUZVMVSA-N |
| XLogP | 4.48 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|