C24H40N2O3 — CID 91152177
N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-methoxy-3-pyrrolidin-1-ylpropan-2-yl]octan-1-amine (PubChem CID 91152177) has the molecular formula C24H40N2O3 and a molecular weight of 404.60 g/mol. Its IUPAC name is N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-methoxy-3-pyrrolidin-1-ylpropan-2-yl]octan-1-amine.
| Compound Name | N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-methoxy-3-pyrrolidin-1-ylpropan-2-yl]octan-1-amine |
|---|---|
| PubChem CID | 91152177 |
| Molecular Formula | C24H40N2O3 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.30 |
| IUPAC Name | N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-methoxy-3-pyrrolidin-1-ylpropan-2-yl]octan-1-amine |
| SMILES | CCCCCCCCNC(CN1CCCC1)C(OC)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C24H40N2O3/c1-3-4-5-6-7-8-13-25-21(19-26-14-9-10-15-26)24(27-2)20-11-12-22-23(18-20)29-17-16-28-22/h11-12,18,21,24-25H,3-10,13-17,19H2,1-2H3 |
| InChIKey | DJFAPQVDRZOFAP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|