C24H38N2O4 — CID 126605202
(1R,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(3-heptyloxiran-2-yl)amino]-3-pyrrolidin-1-ylpropan-1-ol (PubChem CID 126605202) has the molecular formula C24H38N2O4 and a molecular weight of 418.58 g/mol. Its IUPAC name is (1R,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(3-heptyloxiran-2-yl)amino]-3-pyrrolidin-1-ylpropan-1-ol.
| Compound Name | (1R,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(3-heptyloxiran-2-yl)amino]-3-pyrrolidin-1-ylpropan-1-ol |
|---|---|
| PubChem CID | 126605202 |
| Molecular Formula | C24H38N2O4 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | (1R,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(3-heptyloxiran-2-yl)amino]-3-pyrrolidin-1-ylpropan-1-ol |
| SMILES | CCCCCCCC1OC1N[C@H](CN1CCCC1)[C@H](O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C24H38N2O4/c1-2-3-4-5-6-9-21-24(30-21)25-19(17-26-12-7-8-13-26)23(27)18-10-11-20-22(16-18)29-15-14-28-20/h10-11,16,19,21,23-25,27H,2-9,12-15,17H2,1H3/t19-,21?,23-,24?/m1/s1 |
| InChIKey | KPKWPTHXYYRHDL-VCERZCPPSA-N |
| XLogP | 3.63 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|