C23H38N2O3 — CID 148568208
(1R,2R)-3-(diethylamino)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(oct-1-en-2-ylamino)propan-1-ol (PubChem CID 148568208) has the molecular formula C23H38N2O3 and a molecular weight of 390.57 g/mol. Its IUPAC name is (1R,2R)-3-(diethylamino)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(oct-1-en-2-ylamino)propan-1-ol.
| Compound Name | (1R,2R)-3-(diethylamino)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(oct-1-en-2-ylamino)propan-1-ol |
|---|---|
| PubChem CID | 148568208 |
| Molecular Formula | C23H38N2O3 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.29 |
| IUPAC Name | (1R,2R)-3-(diethylamino)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(oct-1-en-2-ylamino)propan-1-ol |
| SMILES | C=C(CCCCCC)N[C@H](CN(CC)CC)[C@H](O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C23H38N2O3/c1-5-8-9-10-11-18(4)24-20(17-25(6-2)7-3)23(26)19-12-13-21-22(16-19)28-15-14-27-21/h12-13,16,20,23-24,26H,4-11,14-15,17H2,1-3H3/t20-,23-/m1/s1 |
| InChIKey | MWIWTFLDIZRPIU-NFBKMPQASA-N |
| XLogP | 4.28 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|