C20H23NO — CID 56796182
N-(1,3-diphenylpropyl)-2-methylcyclopropane-1-carboxamide (PubChem CID 56796182) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is N-(1,3-diphenylpropyl)-2-methylcyclopropane-1-carboxamide.
| Compound Name | N-(1,3-diphenylpropyl)-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 56796182 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | N-(1,3-diphenylpropyl)-2-methylcyclopropane-1-carboxamide |
| SMILES | CC1CC1C(=O)NC(CCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H23NO/c1-15-14-18(15)20(22)21-19(17-10-6-3-7-11-17)13-12-16-8-4-2-5-9-16/h2-11,15,18-19H,12-14H2,1H3,(H,21,22) |
| InChIKey | WAWDGGPFVFIKCN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |