C25H33N3O — CID 112834731
1-[(1-cyclopropylpyrrolidin-3-yl)methyl]-3-(1,4-diphenylbutyl)urea (PubChem CID 112834731) has the molecular formula C25H33N3O and a molecular weight of 391.56 g/mol. Its IUPAC name is 1-[(1-cyclopropylpyrrolidin-3-yl)methyl]-3-(1,4-diphenylbutyl)urea.
| Compound Name | 1-[(1-cyclopropylpyrrolidin-3-yl)methyl]-3-(1,4-diphenylbutyl)urea |
|---|---|
| PubChem CID | 112834731 |
| Molecular Formula | C25H33N3O |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | 1-[(1-cyclopropylpyrrolidin-3-yl)methyl]-3-(1,4-diphenylbutyl)urea |
| SMILES | O=C(NCC1CCN(C2CC2)C1)NC(CCCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H33N3O/c29-25(26-18-21-16-17-28(19-21)23-14-15-23)27-24(22-11-5-2-6-12-22)13-7-10-20-8-3-1-4-9-20/h1-6,8-9,11-12,21,23-24H,7,10,13-19H2,(H2,26,27,29) |
| InChIKey | KDFRHDODKHUCKP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |