C19H17F2NO4 — CID 120975940
2-[[3-fluoro-4-[(3-fluorophenyl)methoxy]phenyl]carbamoyl]cyclobutane-1-carboxylic acid (PubChem CID 120975940) has the molecular formula C19H17F2NO4 and a molecular weight of 361.34 g/mol. Its IUPAC name is 2-[[3-fluoro-4-[(3-fluorophenyl)methoxy]phenyl]carbamoyl]cyclobutane-1-carboxylic acid.
| Compound Name | 2-[[3-fluoro-4-[(3-fluorophenyl)methoxy]phenyl]carbamoyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 120975940 |
| Molecular Formula | C19H17F2NO4 |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 2-[[3-fluoro-4-[(3-fluorophenyl)methoxy]phenyl]carbamoyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC1C(=O)Nc1ccc(OCc2cccc(F)c2)c(F)c1 |
| InChI | InChI=1S/C19H17F2NO4/c20-12-3-1-2-11(8-12)10-26-17-7-4-13(9-16(17)21)22-18(23)14-5-6-15(14)19(24)25/h1-4,7-9,14-15H,5-6,10H2,(H,22,23)(H,24,25) |
| InChIKey | NQFDYILXGKIKAU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |