C17H13F2NO2 — CID 167449564
N-[3-fluoro-4-[(3-fluorophenyl)methoxy]phenyl]but-3-ynamide (PubChem CID 167449564) has the molecular formula C17H13F2NO2 and a molecular weight of 301.29 g/mol. Its IUPAC name is N-[3-fluoro-4-[(3-fluorophenyl)methoxy]phenyl]but-3-ynamide.
| Compound Name | N-[3-fluoro-4-[(3-fluorophenyl)methoxy]phenyl]but-3-ynamide |
|---|---|
| PubChem CID | 167449564 |
| Molecular Formula | C17H13F2NO2 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | N-[3-fluoro-4-[(3-fluorophenyl)methoxy]phenyl]but-3-ynamide |
| SMILES | C#CCC(=O)Nc1ccc(OCc2cccc(F)c2)c(F)c1 |
| InChI | InChI=1S/C17H13F2NO2/c1-2-4-17(21)20-14-7-8-16(15(19)10-14)22-11-12-5-3-6-13(18)9-12/h1,3,5-10H,4,11H2,(H,20,21) |
| InChIKey | SWSRIJKGVBEIKL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|