C18H14FNO2 — CID 167449764
N-[4-[(3-ethynylphenyl)methoxy]-3-fluorophenyl]prop-2-enamide (PubChem CID 167449764) has the molecular formula C18H14FNO2 and a molecular weight of 295.31 g/mol. Its IUPAC name is N-[4-[(3-ethynylphenyl)methoxy]-3-fluorophenyl]prop-2-enamide.
| Compound Name | N-[4-[(3-ethynylphenyl)methoxy]-3-fluorophenyl]prop-2-enamide |
|---|---|
| PubChem CID | 167449764 |
| Molecular Formula | C18H14FNO2 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | N-[4-[(3-ethynylphenyl)methoxy]-3-fluorophenyl]prop-2-enamide |
| SMILES | C#Cc1cccc(COc2ccc(NC(=O)C=C)cc2F)c1 |
| InChI | InChI=1S/C18H14FNO2/c1-3-13-6-5-7-14(10-13)12-22-17-9-8-15(11-16(17)19)20-18(21)4-2/h1,4-11H,2,12H2,(H,20,21) |
| InChIKey | JYZYWVCXWLPDSK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|