C16H12Cl2FNO2 — CID 167449588
N-[4-[(2,5-dichlorophenyl)methoxy]-3-fluorophenyl]prop-2-enamide (PubChem CID 167449588) has the molecular formula C16H12Cl2FNO2 and a molecular weight of 340.18 g/mol. Its IUPAC name is N-[4-[(2,5-dichlorophenyl)methoxy]-3-fluorophenyl]prop-2-enamide.
| Compound Name | N-[4-[(2,5-dichlorophenyl)methoxy]-3-fluorophenyl]prop-2-enamide |
|---|---|
| PubChem CID | 167449588 |
| Molecular Formula | C16H12Cl2FNO2 |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | N-[4-[(2,5-dichlorophenyl)methoxy]-3-fluorophenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(OCc2cc(Cl)ccc2Cl)c(F)c1 |
| InChI | InChI=1S/C16H12Cl2FNO2/c1-2-16(21)20-12-4-6-15(14(19)8-12)22-9-10-7-11(17)3-5-13(10)18/h2-8H,1,9H2,(H,20,21) |
| InChIKey | SCODXEDVODDVIX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|