C15H12ClFN2O2 — CID 167449544
N-[4-[(2-chloro-3-pyridinyl)methoxy]-3-fluorophenyl]prop-2-enamide (PubChem CID 167449544) has the molecular formula C15H12ClFN2O2 and a molecular weight of 306.72 g/mol. Its IUPAC name is N-[4-[(2-chloro-3-pyridinyl)methoxy]-3-fluorophenyl]prop-2-enamide.
| Compound Name | N-[4-[(2-chloro-3-pyridinyl)methoxy]-3-fluorophenyl]prop-2-enamide |
|---|---|
| PubChem CID | 167449544 |
| Molecular Formula | C15H12ClFN2O2 |
| Molecular Weight | 306.72 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | N-[4-[(2-chloro-3-pyridinyl)methoxy]-3-fluorophenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(OCc2cccnc2Cl)c(F)c1 |
| InChI | InChI=1S/C15H12ClFN2O2/c1-2-14(20)19-11-5-6-13(12(17)8-11)21-9-10-4-3-7-18-15(10)16/h2-8H,1,9H2,(H,19,20) |
| InChIKey | LYMBQABNCRCKHP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.72 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|