C17H17F2N3O3 — CID 95324364
(2S)-N-carbamoyl-2-[3-fluoro-4-[(3-fluorophenyl)methoxy]anilino]propanamide (PubChem CID 95324364) has the molecular formula C17H17F2N3O3 and a molecular weight of 349.34 g/mol. Its IUPAC name is (2S)-N-carbamoyl-2-[3-fluoro-4-[(3-fluorophenyl)methoxy]anilino]propanamide.
| Compound Name | (2S)-N-carbamoyl-2-[3-fluoro-4-[(3-fluorophenyl)methoxy]anilino]propanamide |
|---|---|
| PubChem CID | 95324364 |
| Molecular Formula | C17H17F2N3O3 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | (2S)-N-carbamoyl-2-[3-fluoro-4-[(3-fluorophenyl)methoxy]anilino]propanamide |
| SMILES | C[C@H](Nc1ccc(OCc2cccc(F)c2)c(F)c1)C(=O)NC(N)=O |
| InChI | InChI=1S/C17H17F2N3O3/c1-10(16(23)22-17(20)24)21-13-5-6-15(14(19)8-13)25-9-11-3-2-4-12(18)7-11/h2-8,10,21H,9H2,1H3,(H3,20,22,23,24)/t10-/m0/s1 |
| InChIKey | OGZZWTWZQMIUIM-JTQLQIEISA-N |
| XLogP | 2.54 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|