C16H19N3O4 — CID 94643107
(2R)-N-carbamoyl-2-[3-(furan-2-ylmethoxymethyl)anilino]propanamide (PubChem CID 94643107) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is (2R)-N-carbamoyl-2-[3-(furan-2-ylmethoxymethyl)anilino]propanamide.
| Compound Name | (2R)-N-carbamoyl-2-[3-(furan-2-ylmethoxymethyl)anilino]propanamide |
|---|---|
| PubChem CID | 94643107 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (2R)-N-carbamoyl-2-[3-(furan-2-ylmethoxymethyl)anilino]propanamide |
| SMILES | C[C@@H](Nc1cccc(COCc2ccco2)c1)C(=O)NC(N)=O |
| InChI | InChI=1S/C16H19N3O4/c1-11(15(20)19-16(17)21)18-13-5-2-4-12(8-13)9-22-10-14-6-3-7-23-14/h2-8,11,18H,9-10H2,1H3,(H3,17,19,20,21)/t11-/m1/s1 |
| InChIKey | GJNICLRRXHQXAN-LLVKDONJSA-N |
| XLogP | 1.99 |
| TPSA | 106.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |