C21H19F2NO5 — CID 55806690
3-(difluoromethoxy)-N-[3-(furan-2-ylmethoxymethyl)phenyl]-4-methoxybenzamide (PubChem CID 55806690) has the molecular formula C21H19F2NO5 and a molecular weight of 403.38 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-[3-(furan-2-ylmethoxymethyl)phenyl]-4-methoxybenzamide.
| Compound Name | 3-(difluoromethoxy)-N-[3-(furan-2-ylmethoxymethyl)phenyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 55806690 |
| Molecular Formula | C21H19F2NO5 |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 3-(difluoromethoxy)-N-[3-(furan-2-ylmethoxymethyl)phenyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(COCc3ccco3)c2)cc1OC(F)F |
| InChI | InChI=1S/C21H19F2NO5/c1-26-18-8-7-15(11-19(18)29-21(22)23)20(25)24-16-5-2-4-14(10-16)12-27-13-17-6-3-9-28-17/h2-11,21H,12-13H2,1H3,(H,24,25) |
| InChIKey | GNFDNXNRLJEGSH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |