C19H26N2O4 — CID 111754666
3-[3-(furan-2-ylmethoxymethyl)phenyl]-1-(2-hydroxypropyl)-1-propan-2-ylurea (PubChem CID 111754666) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 3-[3-(furan-2-ylmethoxymethyl)phenyl]-1-(2-hydroxypropyl)-1-propan-2-ylurea.
| Compound Name | 3-[3-(furan-2-ylmethoxymethyl)phenyl]-1-(2-hydroxypropyl)-1-propan-2-ylurea |
|---|---|
| PubChem CID | 111754666 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 3-[3-(furan-2-ylmethoxymethyl)phenyl]-1-(2-hydroxypropyl)-1-propan-2-ylurea |
| SMILES | CC(O)CN(C(=O)Nc1cccc(COCc2ccco2)c1)C(C)C |
| InChI | InChI=1S/C19H26N2O4/c1-14(2)21(11-15(3)22)19(23)20-17-7-4-6-16(10-17)12-24-13-18-8-5-9-25-18/h4-10,14-15,22H,11-13H2,1-3H3,(H,20,23) |
| InChIKey | KOXZWSFCYPICPD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 74.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |