C15H12ClFN2O3 — CID 97061708
methyl (2R)-2-(4-chloro-3-fluorophenyl)-2-(pyridine-3-carbonylamino)acetate (PubChem CID 97061708) has the molecular formula C15H12ClFN2O3 and a molecular weight of 322.72 g/mol. Its IUPAC name is methyl (2R)-2-(4-chloro-3-fluorophenyl)-2-(pyridine-3-carbonylamino)acetate.
| Compound Name | methyl (2R)-2-(4-chloro-3-fluorophenyl)-2-(pyridine-3-carbonylamino)acetate |
|---|---|
| PubChem CID | 97061708 |
| Molecular Formula | C15H12ClFN2O3 |
| Molecular Weight | 322.72 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | methyl (2R)-2-(4-chloro-3-fluorophenyl)-2-(pyridine-3-carbonylamino)acetate |
| SMILES | COC(=O)[C@H](NC(=O)c1cccnc1)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C15H12ClFN2O3/c1-22-15(21)13(9-4-5-11(16)12(17)7-9)19-14(20)10-3-2-6-18-8-10/h2-8,13H,1H3,(H,19,20)/t13-/m1/s1 |
| InChIKey | OEVWTQTWXQGURZ-CYBMUJFWSA-N |
| XLogP | 2.52 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.72 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |