C16H20ClNO3 — CID 718076
(3S)-3-(4-chlorophenyl)-3-(cyclohexanecarbonylamino)propanoic acid (PubChem CID 718076) has the molecular formula C16H20ClNO3 and a molecular weight of 309.79 g/mol. Its IUPAC name is (3S)-3-(4-chlorophenyl)-3-(cyclohexanecarbonylamino)propanoic acid.
| Compound Name | (3S)-3-(4-chlorophenyl)-3-(cyclohexanecarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 718076 |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | (3S)-3-(4-chlorophenyl)-3-(cyclohexanecarbonylamino)propanoic acid |
| SMILES | O=C(O)C[C@H](NC(=O)C1CCCCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H20ClNO3/c17-13-8-6-11(7-9-13)14(10-15(19)20)18-16(21)12-4-2-1-3-5-12/h6-9,12,14H,1-5,10H2,(H,18,21)(H,19,20)/t14-/m0/s1 |
| InChIKey | UUIRWZNSLSACOU-AWEZNQCLSA-N |
| XLogP | 3.55 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |