C19H26ClNO4 — CID 167769900
3-(4-chlorophenyl)-3-[[4-(2-hydroxypropan-2-yl)cyclohexanecarbonyl]amino]propanoic acid (PubChem CID 167769900) has the molecular formula C19H26ClNO4 and a molecular weight of 367.87 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3-[[4-(2-hydroxypropan-2-yl)cyclohexanecarbonyl]amino]propanoic acid.
| Compound Name | 3-(4-chlorophenyl)-3-[[4-(2-hydroxypropan-2-yl)cyclohexanecarbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 167769900 |
| Molecular Formula | C19H26ClNO4 |
| Molecular Weight | 367.87 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 3-(4-chlorophenyl)-3-[[4-(2-hydroxypropan-2-yl)cyclohexanecarbonyl]amino]propanoic acid |
| SMILES | CC(C)(O)C1CCC(C(=O)NC(CC(=O)O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H26ClNO4/c1-19(2,25)14-7-3-13(4-8-14)18(24)21-16(11-17(22)23)12-5-9-15(20)10-6-12/h5-6,9-10,13-14,16,25H,3-4,7-8,11H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | CEDGVUGXZLTLHB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.87 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |