C16H19ClNO3- — CID 6926645
(3R)-3-(4-chlorophenyl)-3-(cyclohexanecarbonylamino)propanoate (PubChem CID 6926645) has the molecular formula C16H19ClNO3- and a molecular weight of 308.78 g/mol. Its IUPAC name is (3R)-3-(4-chlorophenyl)-3-(cyclohexanecarbonylamino)propanoate.
| Compound Name | (3R)-3-(4-chlorophenyl)-3-(cyclohexanecarbonylamino)propanoate |
|---|---|
| PubChem CID | 6926645 |
| Molecular Formula | C16H19ClNO3- |
| Molecular Weight | 308.78 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | (3R)-3-(4-chlorophenyl)-3-(cyclohexanecarbonylamino)propanoate |
| SMILES | O=C([O-])C[C@@H](NC(=O)C1CCCCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H20ClNO3/c17-13-8-6-11(7-9-13)14(10-15(19)20)18-16(21)12-4-2-1-3-5-12/h6-9,12,14H,1-5,10H2,(H,18,21)(H,19,20)/p-1/t14-/m1/s1 |
| InChIKey | UUIRWZNSLSACOU-CQSZACIVSA-M |
| XLogP | 2.22 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.78 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |