C16H20NO3- — CID 8022396
(3R)-3-(cyclohexanecarbonylamino)-3-phenylpropanoate (PubChem CID 8022396) has the molecular formula C16H20NO3- and a molecular weight of 274.34 g/mol. Its IUPAC name is (3R)-3-(cyclohexanecarbonylamino)-3-phenylpropanoate.
| Compound Name | (3R)-3-(cyclohexanecarbonylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 8022396 |
| Molecular Formula | C16H20NO3- |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (3R)-3-(cyclohexanecarbonylamino)-3-phenylpropanoate |
| SMILES | O=C([O-])C[C@@H](NC(=O)C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C16H21NO3/c18-15(19)11-14(12-7-3-1-4-8-12)17-16(20)13-9-5-2-6-10-13/h1,3-4,7-8,13-14H,2,5-6,9-11H2,(H,17,20)(H,18,19)/p-1/t14-/m1/s1 |
| InChIKey | UIHUXKARHPECCF-CQSZACIVSA-M |
| XLogP | 1.56 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |