C18H17BrClNO4 — CID 55369954
methyl 3-[(2-bromo-5-methoxybenzoyl)amino]-3-(4-chlorophenyl)propanoate (PubChem CID 55369954) has the molecular formula C18H17BrClNO4 and a molecular weight of 426.69 g/mol. Its IUPAC name is methyl 3-[(2-bromo-5-methoxybenzoyl)amino]-3-(4-chlorophenyl)propanoate.
| Compound Name | methyl 3-[(2-bromo-5-methoxybenzoyl)amino]-3-(4-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 55369954 |
| Molecular Formula | C18H17BrClNO4 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | methyl 3-[(2-bromo-5-methoxybenzoyl)amino]-3-(4-chlorophenyl)propanoate |
| SMILES | COC(=O)CC(NC(=O)c1cc(OC)ccc1Br)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H17BrClNO4/c1-24-13-7-8-15(19)14(9-13)18(23)21-16(10-17(22)25-2)11-3-5-12(20)6-4-11/h3-9,16H,10H2,1-2H3,(H,21,23) |
| InChIKey | DTLOHCZRVRFPTP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |