C12H14BrNO3 — CID 25139378
methyl (3R)-3-[(4-bromobenzoyl)amino]butanoate (PubChem CID 25139378) has the molecular formula C12H14BrNO3 and a molecular weight of 300.15 g/mol. Its IUPAC name is methyl (3R)-3-[(4-bromobenzoyl)amino]butanoate.
| Compound Name | methyl (3R)-3-[(4-bromobenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 25139378 |
| Molecular Formula | C12H14BrNO3 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | methyl (3R)-3-[(4-bromobenzoyl)amino]butanoate |
| SMILES | COC(=O)C[C@@H](C)NC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H14BrNO3/c1-8(7-11(15)17-2)14-12(16)9-3-5-10(13)6-4-9/h3-6,8H,7H2,1-2H3,(H,14,16)/t8-/m1/s1 |
| InChIKey | UNUCJPROFFTILQ-MRVPVSSYSA-N |
| XLogP | 2.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |