C12H13BrINO3Zn — CID 25140961
iodozinc(1+);methyl (3R)-3-[(4-bromobenzoyl)amino]butanoate (PubChem CID 25140961) has the molecular formula C12H13BrINO3Zn and a molecular weight of 491.44 g/mol. Its IUPAC name is iodozinc(1+);methyl (3R)-3-[(4-bromobenzoyl)amino]butanoate.
| Compound Name | iodozinc(1+);methyl (3R)-3-[(4-bromobenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 25140961 |
| Molecular Formula | C12H13BrINO3Zn |
| Molecular Weight | 491.44 g/mol |
| Exact Mass | 488.84 |
| IUPAC Name | iodozinc(1+);methyl (3R)-3-[(4-bromobenzoyl)amino]butanoate |
| SMILES | [CH2-][C@H](CC(=O)OC)NC(=O)c1ccc(Br)cc1.[Zn+]I |
| InChI | InChI=1S/C12H13BrNO3.HI.Zn/c1-8(7-11(15)17-2)14-12(16)9-3-5-10(13)6-4-9;;/h3-6,8H,1,7H2,2H3,(H,14,16);1H;/q-1;;+2/p-1/t8-;;/m1../s1 |
| InChIKey | PCDKFVPCSDMGLT-YCBDHFTFSA-M |
| XLogP | 2.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|