C13H19ClN2O3 — CID 119274296
methyl 3-[[4-(aminomethyl)benzoyl]amino]butanoate;hydrochloride (PubChem CID 119274296) has the molecular formula C13H19ClN2O3 and a molecular weight of 286.76 g/mol. Its IUPAC name is methyl 3-[[4-(aminomethyl)benzoyl]amino]butanoate;hydrochloride.
| Compound Name | methyl 3-[[4-(aminomethyl)benzoyl]amino]butanoate;hydrochloride |
|---|---|
| PubChem CID | 119274296 |
| Molecular Formula | C13H19ClN2O3 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | methyl 3-[[4-(aminomethyl)benzoyl]amino]butanoate;hydrochloride |
| SMILES | COC(=O)CC(C)NC(=O)c1ccc(CN)cc1.Cl |
| InChI | InChI=1S/C13H18N2O3.ClH/c1-9(7-12(16)18-2)15-13(17)11-5-3-10(8-14)4-6-11;/h3-6,9H,7-8,14H2,1-2H3,(H,15,17);1H |
| InChIKey | PNVBCXWBHRGQFI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |