C17H21BrN2O — CID 63524049
4-bromo-N-(3,3-dimethyl-1-phenylbutyl)-1H-pyrrole-2-carboxamide (PubChem CID 63524049) has the molecular formula C17H21BrN2O and a molecular weight of 349.27 g/mol. Its IUPAC name is 4-bromo-N-(3,3-dimethyl-1-phenylbutyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(3,3-dimethyl-1-phenylbutyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 63524049 |
| Molecular Formula | C17H21BrN2O |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 4-bromo-N-(3,3-dimethyl-1-phenylbutyl)-1H-pyrrole-2-carboxamide |
| SMILES | CC(C)(C)CC(NC(=O)c1cc(Br)c[nH]1)c1ccccc1 |
| InChI | InChI=1S/C17H21BrN2O/c1-17(2,3)10-15(12-7-5-4-6-8-12)20-16(21)14-9-13(18)11-19-14/h4-9,11,15,19H,10H2,1-3H3,(H,20,21) |
| InChIKey | MRRLRFLZODVVCP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |