C17H20BrNOS — CID 63524050
5-bromo-N-(3,3-dimethyl-1-phenylbutyl)thiophene-3-carboxamide (PubChem CID 63524050) has the molecular formula C17H20BrNOS and a molecular weight of 366.32 g/mol. Its IUPAC name is 5-bromo-N-(3,3-dimethyl-1-phenylbutyl)thiophene-3-carboxamide.
| Compound Name | 5-bromo-N-(3,3-dimethyl-1-phenylbutyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 63524050 |
| Molecular Formula | C17H20BrNOS |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 5-bromo-N-(3,3-dimethyl-1-phenylbutyl)thiophene-3-carboxamide |
| SMILES | CC(C)(C)CC(NC(=O)c1csc(Br)c1)c1ccccc1 |
| InChI | InChI=1S/C17H20BrNOS/c1-17(2,3)10-14(12-7-5-4-6-8-12)19-16(20)13-9-15(18)21-11-13/h4-9,11,14H,10H2,1-3H3,(H,19,20) |
| InChIKey | YZMDCYKVXPHDNQ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |