C15H22N2O5S — CID 119204037
4-[[4-(ethylsulfamoyl)benzoyl]amino]-4-methylpentanoic acid (PubChem CID 119204037) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is 4-[[4-(ethylsulfamoyl)benzoyl]amino]-4-methylpentanoic acid.
| Compound Name | 4-[[4-(ethylsulfamoyl)benzoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119204037 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 4-[[4-(ethylsulfamoyl)benzoyl]amino]-4-methylpentanoic acid |
| SMILES | CCNS(=O)(=O)c1ccc(C(=O)NC(C)(C)CCC(=O)O)cc1 |
| InChI | InChI=1S/C15H22N2O5S/c1-4-16-23(21,22)12-7-5-11(6-8-12)14(20)17-15(2,3)10-9-13(18)19/h5-8,16H,4,9-10H2,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | WCQFUVSKTQNAIP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |